Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | 1,1′-dimethyl-[4,4′-bipyridine]-1,1′-diium bis(methyl sulfate) |
IUPAC name: | 1,1′-dimethyl-4,4′-bipyridinium bis(methyl sulfate) |
CAS name: | 1,1′-dimethyl-4,4′-bipyridinium bis(methyl sulfate) |
CAS Reg. No.: | 2074-50-2 |
Formula: | C14H20N2O8S2 |
Activity: | herbicides (quaternary ammonium) |
Notes: | This substance is a derivative of paraquat [4685-14-7]. |
Structure: | |
Pronunciation: | pǎr-a-kwǒt dī-mě-tǐl-sǔl-fāt Guide to British pronunciation |
InChIKey: | WXJYKXOIFICRPR-UHFFFAOYSA-L |
InChI: | InChI=1S/C12H14N2.2CH4O4S/c1-13-7-3-11(4-8-13)12-5-9-14(2)10-6-12;2*1-5-6(2,3)4/h3-10H,1-2H3;2*1H3,(H,2,3,4)/q+2;;/p-2 |
A data sheet from the Compendium of Pesticide Common Names